EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N5O3 |
| Net Charge | 0 |
| Average Mass | 245.283 |
| Monoisotopic Mass | 245.14879 |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C9H19N5O3/c1-5(8(16)17)14-7(15)6(10)3-2-4-13-9(11)12/h5-6H,2-4,10H2,1H3,(H,14,15)(H,16,17)(H4,11,12,13)/t5-,6-/m0/s1 |
| InChIKey | WVRUNFYJIHNFKD-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Ala (CHEBI:73810) has role metabolite (CHEBI:25212) |
| Arg-Ala (CHEBI:73810) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| RF9 (CHEBI:140980) has functional parent Arg-Ala (CHEBI:73810) |
| IUPAC Name |
|---|
| L-arginyl-L-alanine |
| Synonyms | Source |
|---|---|
| RA | ChEBI |
| arginylalanine | ChEBI |
| L-Arg-L-Ala | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028702 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729047 | Reaxys |
| CAS:40968-45-4 | Reaxys |