EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38N6O3 |
| Net Charge | 0 |
| Average Mass | 482.629 |
| Monoisotopic Mass | 482.30054 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C26H38N6O3/c27-22(33)21(12-16-5-2-1-3-6-16)31-23(34)20(7-4-8-30-25(28)29)32-24(35)26-13-17-9-18(14-26)11-19(10-17)15-26/h1-3,5-6,17-21H,4,7-15H2,(H2,27,33)(H,31,34)(H,32,35)(H4,28,29,30)/t17?,18?,19?,20-,21-,26?/m0/s1 |
| InChIKey | UMKHUSRDQFQHAK-RNJMTYCLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neuropeptide FF receptor antagonist An antagonist that binds to and deactivates neuropeptide FF receptors. neuropeptide FF receptor agonist An agonist that activates neuropeptide FF (NPFF) receptors. kisspeptin receptor agonist An agonist that acts at the kisspeptin receptor (KISS1R). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RF9 (CHEBI:140980) has functional parent Arg-Ala (CHEBI:73810) |
| RF9 (CHEBI:140980) has role kisspeptin receptor agonist (CHEBI:141001) |
| RF9 (CHEBI:140980) has role neuropeptide FF receptor agonist (CHEBI:141000) |
| RF9 (CHEBI:140980) has role neuropeptide FF receptor antagonist (CHEBI:140982) |
| RF9 (CHEBI:140980) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N2-(tricyclo[3.3.1.13,7]decan-1-ylcarbonyl)-L-arginyl-L-phenylalaninamide |
| Synonyms | Source |
|---|---|
| 1-adamantanecarbonyl-Arg-Phe-NH2 | ChEBI |
| neuropeptide FF receptor antagonist | SUBMITTER |
| NPFF receptor antagonist | SUBMITTER |
| RF 9 | SUBMITTER |
| RF-9 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:876310-60-0 | SUBMITTER |
| Citations |
|---|