EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18F3NO5S2 |
| Net Charge | 0 |
| Average Mass | 485.505 |
| Monoisotopic Mass | 485.05785 |
| SMILES | Cc1cc(S(=O)(=O)Cc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H18F3NO5S2/c1-12-9-16(7-8-17(12)30-10-19(26)27)32(28,29)11-18-13(2)25-20(31-18)14-3-5-15(6-4-14)21(22,23)24/h3-9H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | FGSAXXBOZZGAEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW 501516 sulfone (CHEBI:73791) has functional parent GW 501516 (CHEBI:73726) |
| GW 501516 sulfone (CHEBI:73791) has functional parent GW 501516 sulfoxide (CHEBI:73790) |
| GW 501516 sulfone (CHEBI:73791) is a 1,3-thiazoles (CHEBI:38418) |
| GW 501516 sulfone (CHEBI:73791) is a aromatic ether (CHEBI:35618) |
| GW 501516 sulfone (CHEBI:73791) is a monocarboxylic acid (CHEBI:25384) |
| GW 501516 sulfone (CHEBI:73791) is a organofluorine compound (CHEBI:37143) |
| GW 501516 sulfone (CHEBI:73791) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| {2-methyl-4-[({4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methyl)sulfonyl]phenoxy}acetic acid |
| Synonyms | Source |
|---|---|
| Endurobol sulfone | ChEBI |
| GW 1516 sulfone | ChEBI |
| GW-1516 sulfone | ChEBI |
| GW1516 sulfone | ChEBI |
| GW 501,516 sulfone | ChEBI |
| GW-501,516 sulfone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14259911 | Reaxys |
| Citations |
|---|