EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18F3NO3S2 |
| Net Charge | 0 |
| Average Mass | 453.507 |
| Monoisotopic Mass | 453.06802 |
| SMILES | Cc1cc(SCc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H18F3NO3S2/c1-12-9-16(7-8-17(12)28-10-19(26)27)29-11-18-13(2)25-20(30-18)14-3-5-15(6-4-14)21(22,23)24/h3-9H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | YDBLKRPLXZNVNB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARbeta/delta agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-β/δ. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GW 501516 (CHEBI:73726) has role carcinogenic agent (CHEBI:50903) |
| GW 501516 (CHEBI:73726) has role PPARβ/δ agonist (CHEBI:73730) |
| GW 501516 (CHEBI:73726) is a 1,3-thiazoles (CHEBI:38418) |
| GW 501516 (CHEBI:73726) is a aromatic ether (CHEBI:35618) |
| GW 501516 (CHEBI:73726) is a aryl sulfide (CHEBI:35683) |
| GW 501516 (CHEBI:73726) is a monocarboxylic acid (CHEBI:25384) |
| GW 501516 (CHEBI:73726) is a organofluorine compound (CHEBI:37143) |
| Incoming Relation(s) |
| GW 501516 sulfone (CHEBI:73791) has functional parent GW 501516 (CHEBI:73726) |
| GW 501516 sulfoxide (CHEBI:73790) has functional parent GW 501516 (CHEBI:73726) |
| IUPAC Name |
|---|
| {2-methyl-4-[({4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl}methyl)sulfanyl]phenoxy}acetic acid |
| Synonyms | Source |
|---|---|
| Endurobol | ChEBI |
| GSK-516 | ChEBI |
| GW 1516 | ChEBI |
| GW-1516 | ChEBI |
| GW1516 | ChEBI |
| GW 501,516 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9440826 | Reaxys |
| CAS:317318-70-0 | ChemIDplus |
| Citations |
|---|