EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O5 |
| Net Charge | 0 |
| Average Mass | 220.225 |
| Monoisotopic Mass | 220.10592 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C8H16N2O5/c1-3(11)5(9)7(13)10-6(4(2)12)8(14)15/h3-6,11-12H,9H2,1-2H3,(H,10,13)(H,14,15)/t3-,4-,5+,6+/m1/s1 |
| InChIKey | DSGIVWSDDRDJIO-ZXXMMSQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Thr (CHEBI:73665) has functional parent L-threonine (CHEBI:16857) |
| Thr-Thr (CHEBI:73665) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Thr-Thr (CHEBI:73665) is a dipeptide (CHEBI:46761) |
| Thr-Thr (CHEBI:73665) is tautomer of Thr-Thr zwitterion (CHEBI:169953) |
| Incoming Relation(s) |
| Thr-Thr zwitterion (CHEBI:169953) is tautomer of Thr-Thr (CHEBI:73665) |
| IUPAC Name |
|---|
| L-threonyl-L-threonine |
| Synonyms | Source |
|---|---|
| TT | ChEBI |
| T-T | ChEBI |
| L-Thr-L-Thr | ChEBI |
| H-L-Thr-L-Thr-OH | ChEBI |
| H-Thr-Thr-OH | ChEBI |
| Threoninyl-Threonine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029071 | HMDB |