EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O5 |
| Net Charge | 0 |
| Average Mass | 220.225 |
| Monoisotopic Mass | 220.10592 |
| SMILES | C[C@@H](O)[C@H]([NH3+])C(=O)N[C@H](C(=O)[O-])[C@@H](C)O |
| InChI | InChI=1S/C8H16N2O5/c1-3(11)5(9)7(13)10-6(4(2)12)8(14)15/h3-6,11-12H,9H2,1-2H3,(H,10,13)(H,14,15)/t3-,4-,5+,6+/m1/s1 |
| InChIKey | DSGIVWSDDRDJIO-ZXXMMSQZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Thr zwitterion (CHEBI:169953) is a dipeptide zwitterion (CHEBI:90799) |
| Thr-Thr zwitterion (CHEBI:169953) is tautomer of Thr-Thr (CHEBI:73665) |
| Incoming Relation(s) |
| Thr-Thr (CHEBI:73665) is tautomer of Thr-Thr zwitterion (CHEBI:169953) |
| IUPAC Name |
|---|
| (2S,3R)-2-{[(2S,3R)-2-azaniumyl-3-hydroxybutanoyl]amino}-3-hydroxybutanoate |
| Synonyms | Source |
|---|---|
| L-Thr-L-Thr zwitterion | ChEBI |
| threoninyl-threonine zwitterion | ChEBI |
| H-L-Thr-L-Thr-OH zwitterion | ChEBI |
| T-T zwitterion | ChEBI |
| TT zwitterion | ChEBI |
| H-Thr-Thr-OH zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-threonyl-L-threonine | UniProt |
| Citations |
|---|