EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O5 |
| Net Charge | 0 |
| Average Mass | 206.198 |
| Monoisotopic Mass | 206.09027 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H14N2O5/c1-3(11)5(8)6(12)9-4(2-10)7(13)14/h3-5,10-11H,2,8H2,1H3,(H,9,12)(H,13,14)/t3-,4+,5+/m1/s1 |
| InChIKey | GXDLGHLJTHMDII-WISUUJSJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Ser (CHEBI:73664) has functional parent L-serine (CHEBI:17115) |
| Thr-Ser (CHEBI:73664) has functional parent L-threonine (CHEBI:16857) |
| Thr-Ser (CHEBI:73664) has role metabolite (CHEBI:25212) |
| Thr-Ser (CHEBI:73664) is a dipeptide (CHEBI:46761) |
| Thr-Ser (CHEBI:73664) is tautomer of Thr-Ser zwitterion (CHEBI:169954) |
| Incoming Relation(s) |
| Thr-Ser zwitterion (CHEBI:169954) is tautomer of Thr-Ser (CHEBI:73664) |
| IUPAC Name |
|---|
| L-threonyl-L-serine |
| Synonyms | Source |
|---|---|
| TS | ChEBI |
| T-S | ChEBI |
| L-Thr-L-Ser | ChEBI |
| threonylserine | ChEBI |
| H-Thr-Ser-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029070 | HMDB |
| Citations |
|---|