EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O5 |
| Net Charge | 0 |
| Average Mass | 206.198 |
| Monoisotopic Mass | 206.09027 |
| SMILES | C[C@@H](O)[C@H]([NH3+])C(=O)N[C@@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O5/c1-3(11)5(8)6(12)9-4(2-10)7(13)14/h3-5,10-11H,2,8H2,1H3,(H,9,12)(H,13,14)/t3-,4+,5+/m1/s1 |
| InChIKey | GXDLGHLJTHMDII-WISUUJSJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Ser zwitterion (CHEBI:169954) is a dipeptide zwitterion (CHEBI:90799) |
| Thr-Ser zwitterion (CHEBI:169954) is tautomer of Thr-Ser (CHEBI:73664) |
| Incoming Relation(s) |
| Thr-Ser (CHEBI:73664) is tautomer of Thr-Ser zwitterion (CHEBI:169954) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S,3R)-2-azaniumyl-3-hydroxybutanoyl]amino}-3-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| T-S zwitterion | ChEBI |
| TS zwitterion | ChEBI |
| threonylserine zwitterion | ChEBI |
| L-Thr-L-Ser zwitterion | ChEBI |
| L-threonyl-L-serine zwitterion | ChEBI |
| H-Thr-Ser-OH zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-threonyl-L-serine | UniProt |
| Citations |
|---|