EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O7 |
| Net Charge | 0 |
| Average Mass | 291.260 |
| Monoisotopic Mass | 291.10665 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H17N3O7/c1-4(14)8(11)10(20)13-5(2-6(15)16)9(19)12-3-7(17)18/h4-5,8,14H,2-3,11H2,1H3,(H,12,19)(H,13,20)(H,15,16)(H,17,18)/t4-,5+,8+/m1/s1 |
| InChIKey | JEDIEMIJYSRUBB-FOHZUACHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Asp-Gly (CHEBI:73658) has functional parent L-aspartic acid (CHEBI:17053) |
| Thr-Asp-Gly (CHEBI:73658) has functional parent L-threonine (CHEBI:16857) |
| Thr-Asp-Gly (CHEBI:73658) has functional parent glycine (CHEBI:15428) |
| Thr-Asp-Gly (CHEBI:73658) has role metabolite (CHEBI:25212) |
| Thr-Asp-Gly (CHEBI:73658) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-threonyl-L-α-aspartylglycine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Asp-Gly | ChEBI |
| T-D-G | ChEBI |
| TDG | ChEBI |