EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N5O5 |
| Net Charge | 0 |
| Average Mass | 457.531 |
| Monoisotopic Mass | 457.23252 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@@H]1CCCN1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H31N5O5/c1-13(2)20(23(33)26-12-19(29)30)28-22(32)18(27-21(31)17-8-5-9-24-17)10-14-11-25-16-7-4-3-6-15(14)16/h3-4,6-7,11,13,17-18,20,24-25H,5,8-10,12H2,1-2H3,(H,26,33)(H,27,31)(H,28,32)(H,29,30)/t17-,18-,20-/m0/s1 |
| InChIKey | MMFLWRSVOVXBDP-BJLQDIEVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Trp-Val-Gly (CHEBI:73650) has functional parent L-proline (CHEBI:17203) |
| Pro-Trp-Val-Gly (CHEBI:73650) has functional parent L-tryptophan (CHEBI:16828) |
| Pro-Trp-Val-Gly (CHEBI:73650) has functional parent L-valine (CHEBI:16414) |
| Pro-Trp-Val-Gly (CHEBI:73650) has functional parent glycine (CHEBI:15428) |
| Pro-Trp-Val-Gly (CHEBI:73650) has role metabolite (CHEBI:25212) |
| Pro-Trp-Val-Gly (CHEBI:73650) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-prolyl-L-tryptophyl-L-valylglycine |
| Synonyms | Source |
|---|---|
| L-Pro-L-Trp-L-Val-Gly | ChEBI |
| P-W-V-G | ChEBI |
| PWVG | ChEBI |