EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28N4O5 |
| Net Charge | 0 |
| Average Mass | 368.434 |
| Monoisotopic Mass | 368.20597 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1)C(=O)NCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C17H28N4O5/c1-10(2)14(20-15(23)11-5-3-7-18-11)16(24)19-9-13(22)21-8-4-6-12(21)17(25)26/h10-12,14,18H,3-9H2,1-2H3,(H,19,24)(H,20,23)(H,25,26)/t11-,12-,14-/m0/s1 |
| InChIKey | UCTIUWKCVNGEFH-OBJOEFQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Val-Gly-Pro (CHEBI:73649) has functional parent L-proline (CHEBI:17203) |
| Pro-Val-Gly-Pro (CHEBI:73649) has functional parent L-valine (CHEBI:16414) |
| Pro-Val-Gly-Pro (CHEBI:73649) has functional parent glycine (CHEBI:15428) |
| Pro-Val-Gly-Pro (CHEBI:73649) has role metabolite (CHEBI:25212) |
| Pro-Val-Gly-Pro (CHEBI:73649) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-prolyl-L-valylglycyl-L-proline |
| Synonyms | Source |
|---|---|
| P-V-G-P | ChEBI |
| PVGP | ChEBI |
| L-Pro-L-Val-Gly-L-Pro | ChEBI |