EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N5O3 |
| Net Charge | 0 |
| Average Mass | 321.381 |
| Monoisotopic Mass | 321.18009 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H23N5O3/c16-11(9-10-5-2-1-3-6-10)13(21)20-12(14(22)23)7-4-8-19-15(17)18/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/t11-,12-/m0/s1 |
| InChIKey | OZILORBBPKKGRI-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Arg (CHEBI:73632) has functional parent L-arginine (CHEBI:16467) |
| Phe-Arg (CHEBI:73632) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Arg (CHEBI:73632) has role metabolite (CHEBI:25212) |
| Phe-Arg (CHEBI:73632) is a dipeptide (CHEBI:46761) |
| Phe-Arg (CHEBI:73632) is conjugate base of Phe-Arg(1+) (CHEBI:133147) |
| Incoming Relation(s) |
| Phe-Arg(1+) (CHEBI:133147) is conjugate acid of Phe-Arg (CHEBI:73632) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-arginine |
| Synonyms | Source |
|---|---|
| L-Phe-L-Arg | ChEBI |
| FR | ChEBI |
| F-R | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028989 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2898673 | Reaxys |
| CAS:1238-09-1 | ChemIDplus |