EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N5O3 |
| Net Charge | +1 |
| Average Mass | 322.389 |
| Monoisotopic Mass | 322.18737 |
| SMILES | NC(=[NH2+])NCCC[C@H](NC(=O)[C@@H]([NH3+])Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H23N5O3/c16-11(9-10-5-2-1-3-6-10)13(21)20-12(14(22)23)7-4-8-19-15(17)18/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | OZILORBBPKKGRI-RYUDHWBXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Arg(1+) (CHEBI:133147) is a peptide cation (CHEBI:60194) |
| Phe-Arg(1+) (CHEBI:133147) is conjugate acid of Phe-Arg (CHEBI:73632) |
| Incoming Relation(s) |
| Phe-Arg (CHEBI:73632) is conjugate base of Phe-Arg(1+) (CHEBI:133147) |
| IUPAC Name |
|---|
| (2S)-5-{[azaniumyl(imino)methyl]amino}-2-{[(2S)-2-azaniumyl-3-phenylpropanoyl]amino}pentanoate |
| Synonyms | Source |
|---|---|
| phenylalanylarginine(1+) | ChEBI |
| L-phenylalanyl-L-arginine(1+) | ChEBI |
| L-Phe-L-Arg(1+) | ChEBI |
| FR(1+) | ChEBI |
| phenylalanylarginine | ChEBI |
| UniProt Name | Source |
|---|---|
| L-Phe-L-Arg | UniProt |