EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O6S |
| Net Charge | 0 |
| Average Mass | 383.426 |
| Monoisotopic Mass | 383.11511 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C16H21N3O6S/c17-10(6-9-4-2-1-3-5-9)14(22)18-11(7-13(20)21)15(23)19-12(8-26)16(24)25/h1-5,10-12,26H,6-8,17H2,(H,18,22)(H,19,23)(H,20,21)(H,24,25)/t10-,11-,12-/m0/s1 |
| InChIKey | UEXCHCYDPAIVDE-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Asp-Cys (CHEBI:73629) has functional parent L-aspartic acid (CHEBI:17053) |
| Phe-Asp-Cys (CHEBI:73629) has functional parent L-cysteine (CHEBI:17561) |
| Phe-Asp-Cys (CHEBI:73629) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Asp-Cys (CHEBI:73629) has role metabolite (CHEBI:25212) |
| Phe-Asp-Cys (CHEBI:73629) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-α-aspartyl-L-cysteine |
| Synonyms | Source |
|---|---|
| L-Phe-L-Asp-L-Cys | ChEBI |
| F-D-C | ChEBI |
| FDC | ChEBI |