EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22N2O3S |
| Net Charge | 0 |
| Average Mass | 262.375 |
| Monoisotopic Mass | 262.13511 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-7(2)6-8(12)10(14)13-9(11(15)16)4-5-17-3/h7-9H,4-6,12H2,1-3H3,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | NTISAKGPIGTIJJ-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Met (CHEBI:73584) has functional parent L-leucine (CHEBI:15603) |
| Leu-Met (CHEBI:73584) has functional parent L-methionine (CHEBI:16643) |
| Leu-Met (CHEBI:73584) has role metabolite (CHEBI:25212) |
| Leu-Met (CHEBI:73584) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-methionine |
| Synonyms | Source |
|---|---|
| Leucylmethionine | ChemIDplus |
| L-M | ChEBI |
| LM | ChEBI |
| L-Leu-L-Met | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028935 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2731630 | Reaxys |
| CAS:36077-39-1 | ChemIDplus |