EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27N3O4 |
| Net Charge | 0 |
| Average Mass | 301.387 |
| Monoisotopic Mass | 301.20016 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H27N3O4/c1-8(2)5-10(15)13(20)17-11(6-9(3)4)14(21)16-7-12(18)19/h8-11H,5-7,15H2,1-4H3,(H,16,21)(H,17,20)(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | YOKVEHGYYQEQOP-QWRGUYRKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Leu-Gly (CHEBI:73568) has functional parent L-leucine (CHEBI:15603) |
| Leu-Leu-Gly (CHEBI:73568) has functional parent glycine (CHEBI:15428) |
| Leu-Leu-Gly (CHEBI:73568) has role metabolite (CHEBI:25212) |
| Leu-Leu-Gly (CHEBI:73568) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-leucylglycine |
| Synonyms | Source |
|---|---|
| LLG | ChEBI |
| L-Leu-L-Leu-Gly | ChEBI |
| L-L-G | ChEBI |