EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O4 |
| Net Charge | 0 |
| Average Mass | 162.145 |
| Monoisotopic Mass | 162.06406 |
| SMILES | NCC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-1-4(9)7-3(2-8)5(10)11/h3,8H,1-2,6H2,(H,7,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | BCCRXDTUTZHDEU-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Ser (CHEBI:73516) has functional parent L-serine (CHEBI:17115) |
| Gly-Ser (CHEBI:73516) has functional parent glycine (CHEBI:15428) |
| Gly-Ser (CHEBI:73516) has role metabolite (CHEBI:25212) |
| Gly-Ser (CHEBI:73516) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| N2-[(R)-2-amino-2-(4-hydroxyphenyl)acetyl]-N-butyl-L-serinamide (CHEBI:63200) has parent hydride Gly-Ser (CHEBI:73516) |
| IUPAC Name |
|---|
| glycyl-L-serine |
| Synonyms | Source |
|---|---|
| Gly-L-Ser | ChEBI |
| G-S | ChEBI |
| GS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028850 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725866 | Reaxys |
| CAS:7361-43-5 | ChemIDplus |