EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC(C)C[C@H](NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)3-6(8(12)13)10-7(11)4-9/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | DKEXFJVMVGETOO-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-Leu (CHEBI:73514) has functional parent L-leucine (CHEBI:15603) |
| Gly-Leu (CHEBI:73514) has functional parent glycine (CHEBI:15428) |
| Gly-Leu (CHEBI:73514) has role metabolite (CHEBI:25212) |
| Gly-Leu (CHEBI:73514) is a dipeptide (CHEBI:46761) |
| Gly-Leu (CHEBI:73514) is tautomer of glycyl-L-leucine zwitterion (CHEBI:143163) |
| Incoming Relation(s) |
| glycyl-L-leucine zwitterion (CHEBI:143163) is tautomer of Gly-Leu (CHEBI:73514) |
| IUPAC Name |
|---|
| glycyl-L-leucine |
| Synonyms | Source |
|---|---|
| Gly-L-Leu | ChEBI |
| GL | ChEBI |
| G-L | ChEBI |
| glycylleucine | MetaCyc |
| Glycyl-L-leucine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000759 | HMDB |
| CPD-12312 | MetaCyc |
| C02155 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:869-19-2 | ChemIDplus |
| CAS:869-19-2 | KEGG COMPOUND |