EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5 |
| Net Charge | 0 |
| Average Mass | 333.344 |
| Monoisotopic Mass | 333.13247 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24)/t11-,13-/m0/s1 |
| InChIKey | LLEUXCDZPQOJMY-AAEUAGOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Trp (CHEBI:73512) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Trp (CHEBI:73512) has functional parent L-tryptophan (CHEBI:16828) |
| Glu-Trp (CHEBI:73512) has role angiogenesis modulating agent (CHEBI:50926) |
| Glu-Trp (CHEBI:73512) has role antineoplastic agent (CHEBI:35610) |
| Glu-Trp (CHEBI:73512) has role immunomodulator (CHEBI:50846) |
| Glu-Trp (CHEBI:73512) has role metabolite (CHEBI:25212) |
| Glu-Trp (CHEBI:73512) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-tryptophan |
| INN | Source |
|---|---|
| oglufanide | ChemIDplus |
| Synonyms | Source |
|---|---|
| alpha-Glutamyltryptophan | ChemIDplus |
| Glutamyltryptophan | ChemIDplus |
| L-Glu-L-Trp | ChEBI |
| L-α-Glu-L-Trp | ChEBI |
| α-Glu-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028830 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5358533 | Reaxys |
| CAS:38101-59-6 | ChemIDplus |
| Citations |
|---|