EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c9-4(1-2-6(12)13)7(14)10-5(3-11)8(15)16/h4-5,11H,1-3,9H2,(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | UQHGAYSULGRWRG-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Ser (CHEBI:73509) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Ser (CHEBI:73509) has functional parent L-serine (CHEBI:17115) |
| Glu-Ser (CHEBI:73509) has role metabolite (CHEBI:25212) |
| Glu-Ser (CHEBI:73509) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-serine |
| Synonyms | Source |
|---|---|
| E-S | ChEBI |
| L-Glu-L-Ser | ChEBI |
| ES | ChEBI |
| α-glutamylserine | ChEBI |
| glutamylserine | ChEBI |
| α-Glu-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028828 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714268 | Reaxys |