EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O5 |
| Net Charge | 0 |
| Average Mass | 260.290 |
| Monoisotopic Mass | 260.13722 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-10(16)7(12)3-4-9(14)15/h6-8H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | YBAFDPFAUTYYRW-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Leu (CHEBI:73506) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Leu (CHEBI:73506) has functional parent L-leucine (CHEBI:15603) |
| Glu-Leu (CHEBI:73506) has role metabolite (CHEBI:25212) |
| Glu-Leu (CHEBI:73506) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-leucine |
| Synonyms | Source |
|---|---|
| E-L | ChEBI |
| EL | ChEBI |
| L-Glu-L-Leu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028823 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729053 | Reaxys |