EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O7 |
| Net Charge | 0 |
| Average Mass | 262.218 |
| Monoisotopic Mass | 262.08010 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c10-4(1-2-6(12)13)8(16)11-5(9(17)18)3-7(14)15/h4-5H,1-3,10H2,(H,11,16)(H,12,13)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | FYYSIASRLDJUNP-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Asp (CHEBI:73503) has functional parent L-aspartic acid (CHEBI:17053) |
| Glu-Asp (CHEBI:73503) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Asp (CHEBI:73503) has role metabolite (CHEBI:25212) |
| Glu-Asp (CHEBI:73503) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-glutamyl- L-aspartic acid |
| Synonyms | Source |
|---|---|
| E-D | ChEBI |
| ED | ChEBI |
| glutamylaspartic acid | ChEBI |
| L-Glu-L-Asp | ChEBI |
| α-Glu-Asp | ChEBI |
| α-glutamylaspartic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028815 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1715449 | Reaxys |
| CAS:3918-84-1 | ChemIDplus |