EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N3O7 |
| Net Charge | 0 |
| Average Mass | 347.368 |
| Monoisotopic Mass | 347.16925 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C14H25N3O7/c1-3-7(2)11(13(22)16-9(6-18)14(23)24)17-12(21)8(15)4-5-10(19)20/h7-9,11,18H,3-6,15H2,1-2H3,(H,16,22)(H,17,21)(H,19,20)(H,23,24)/t7-,8-,9-,11-/m0/s1 |
| InChIKey | ZHNHJYYFCGUZNQ-KBIXCLLPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Ile-Ser (CHEBI:73498) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Ile-Ser (CHEBI:73498) has functional parent L-isoleucine (CHEBI:17191) |
| Glu-Ile-Ser (CHEBI:73498) has functional parent L-serine (CHEBI:17115) |
| Glu-Ile-Ser (CHEBI:73498) has role metabolite (CHEBI:25212) |
| Glu-Ile-Ser (CHEBI:73498) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-isoleucyl-L-serine |
| Synonyms | Source |
|---|---|
| E-I-S | ChEBI |
| EIS | ChEBI |
| L-Glu-L-Ile-L-Ser | ChEBI |