EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O10 |
| Net Charge | 0 |
| Average Mass | 405.360 |
| Monoisotopic Mass | 405.13834 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H23N3O10/c16-7(1-4-10(19)20)13(25)17-8(2-5-11(21)22)14(26)18-9(15(27)28)3-6-12(23)24/h7-9H,1-6,16H2,(H,17,25)(H,18,26)(H,19,20)(H,21,22)(H,23,24)(H,27,28)/t7-,8-,9-/m0/s1 |
| InChIKey | BUZMZDDKFCSKOT-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu-Glu (CHEBI:73493) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Glu-Glu (CHEBI:73493) has role metabolite (CHEBI:25212) |
| Glu-Glu-Glu (CHEBI:73493) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-glutamyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| E-E-E | ChEBI |
| L-Glu-L-Glu-L-Glu | ChEBI |
| EEE | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1717825 | Reaxys |