EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27N3O8 |
| Net Charge | 0 |
| Average Mass | 389.405 |
| Monoisotopic Mass | 389.17981 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H27N3O8/c1-3-8(2)13(16(26)27)19-15(25)10(5-7-12(22)23)18-14(24)9(17)4-6-11(20)21/h8-10,13H,3-7,17H2,1-2H3,(H,18,24)(H,19,25)(H,20,21)(H,22,23)(H,26,27)/t8-,9-,10-,13-/m0/s1 |
| InChIKey | AUTNXSQEVVHSJK-YVNDNENWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu-Ile (CHEBI:73492) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Glu-Ile (CHEBI:73492) has functional parent L-isoleucine (CHEBI:17191) |
| Glu-Glu-Ile (CHEBI:73492) has role metabolite (CHEBI:25212) |
| Glu-Glu-Ile (CHEBI:73492) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-glutamyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| E-E-I | ChEBI |
| EEI | ChEBI |
| L-Glu-L-Glu-L-Ile | ChEBI |