EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25N3O8 |
| Net Charge | 0 |
| Average Mass | 375.378 |
| Monoisotopic Mass | 375.16416 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25N3O8/c1-3-7(2)12(15(25)26)18-14(24)9(6-11(21)22)17-13(23)8(16)4-5-10(19)20/h7-9,12H,3-6,16H2,1-2H3,(H,17,23)(H,18,24)(H,19,20)(H,21,22)(H,25,26)/t7-,8-,9-,12-/m0/s1 |
| InChIKey | IESFZVCAVACGPH-PEFMBERDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Asp-Ile (CHEBI:73491) has functional parent L-aspartic acid (CHEBI:17053) |
| Glu-Asp-Ile (CHEBI:73491) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Asp-Ile (CHEBI:73491) has functional parent L-isoleucine (CHEBI:17191) |
| Glu-Asp-Ile (CHEBI:73491) has role metabolite (CHEBI:25212) |
| Glu-Asp-Ile (CHEBI:73491) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-aspartyl-L-isoleucine |
| Synonyms | Source |
|---|---|
| E-D-I | ChEBI |
| EDI | ChEBI |
| L-Glu-L-Asp-L-Ile | ChEBI |