EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N4O6 |
| Net Charge | 0 |
| Average Mass | 404.423 |
| Monoisotopic Mass | 404.16958 |
| SMILES | C[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H24N4O6/c1-10(22-18(27)13(20)6-7-16(24)25)17(26)23-15(19(28)29)8-11-9-21-14-5-3-2-4-12(11)14/h2-5,9-10,13,15,21H,6-8,20H2,1H3,(H,22,27)(H,23,26)(H,24,25)(H,28,29)/t10-,13-,15-/m0/s1 |
| InChIKey | RSUVOPBMWMTVDI-XEGUGMAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Ala-Trp (CHEBI:73490) has functional parent L-alanine (CHEBI:16977) |
| Glu-Ala-Trp (CHEBI:73490) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Ala-Trp (CHEBI:73490) has functional parent L-tryptophan (CHEBI:16828) |
| Glu-Ala-Trp (CHEBI:73490) has role metabolite (CHEBI:25212) |
| Glu-Ala-Trp (CHEBI:73490) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-alanyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| L-Glu-L-Ala-L-Trp | ChEBI |
| E-A-W | ChEBI |
| EAW | ChEBI |