EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N4O10 |
| Net Charge | 0 |
| Average Mass | 512.516 |
| Monoisotopic Mass | 512.21184 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCC(=O)O)[C@@H](C)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H32N4O10/c1-10(27)17(20(33)24-15(22(35)36)9-12-3-5-13(29)6-4-12)26-21(34)18(11(2)28)25-19(32)14(23)7-8-16(30)31/h3-6,10-11,14-15,17-18,27-29H,7-9,23H2,1-2H3,(H,24,33)(H,25,32)(H,26,34)(H,30,31)(H,35,36)/t10-,11-,14+,15+,17+,18+/m1/s1 |
| InChIKey | UQULNJAARAXSPO-ZCWPNWOLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Thr-Thr-Tyr (CHEBI:73489) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Thr-Thr-Tyr (CHEBI:73489) has functional parent L-threonine (CHEBI:16857) |
| Glu-Thr-Thr-Tyr (CHEBI:73489) has functional parent L-tyrosine (CHEBI:17895) |
| Glu-Thr-Thr-Tyr (CHEBI:73489) has role metabolite (CHEBI:25212) |
| Glu-Thr-Thr-Tyr (CHEBI:73489) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-threonyl-L-threonyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Glu-L-Thr-L-Thr-L-Tyr | ChEBI |
| E-T-T-Y | ChEBI |
| ETTY | ChEBI |