EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34N6O10 |
| Net Charge | 0 |
| Average Mass | 590.590 |
| Monoisotopic Mass | 590.23364 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H34N6O10/c27-15(5-9-21(34)35)23(38)30-18(7-10-22(36)37)24(39)31-17(6-8-20(28)33)25(40)32-19(26(41)42)11-13-12-29-16-4-2-1-3-14(13)16/h1-4,12,15,17-19,29H,5-11,27H2,(H2,28,33)(H,30,38)(H,31,39)(H,32,40)(H,34,35)(H,36,37)(H,41,42)/t15-,17-,18-,19-/m0/s1 |
| InChIKey | IFZWDJWERARYFC-WNHJNPCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu-Gln-Trp (CHEBI:73484) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Glu-Gln-Trp (CHEBI:73484) has functional parent L-tryptophan (CHEBI:16828) |
| Glu-Glu-Gln-Trp (CHEBI:73484) has role metabolite (CHEBI:25212) |
| Glu-Glu-Gln-Trp (CHEBI:73484) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-glutamyl-L-glutaminyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| E-E-Q-W | ChEBI |
| EEQW | ChEBI |
| L-Glu-L-Glu-L-Gln-L-Trp | ChEBI |