EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO2 |
| Net Charge | +1 |
| Average Mass | 324.444 |
| Monoisotopic Mass | 324.19581 |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26NO2/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/q+1 |
| InChIKey | HYJRTXSYDAFGJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-DAMP(1+) (CHEBI:73467) has role cholinergic antagonist (CHEBI:48873) |
| 4-DAMP(1+) (CHEBI:73467) has role muscarinic antagonist (CHEBI:48876) |
| 4-DAMP(1+) (CHEBI:73467) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| 4-DAMP methiodide (CHEBI:73340) has part 4-DAMP(1+) (CHEBI:73467) |
| IUPAC Name |
|---|
| 4-(2,2-diphenylacetoxy)-1,1-dimethylpiperidinium |
| Synonyms | Source |
|---|---|
| 4-DAMP | ChemIDplus |
| 4-Diphenylacetoxy-1,1-dimethylpiperidinium | ChemIDplus |
| N,N-dimethyl-4-(diphenylacetoxy)piperidinium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3686582 | Reaxys |
| CAS:81405-11-0 | ChemIDplus |