EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO2 |
| Net Charge | +1 |
| Average Mass | 324.444 |
| Monoisotopic Mass | 324.19581 |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26NO2/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/q+1 |
| InChIKey | HYJRTXSYDAFGJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-DAMP(1+) (CHEBI:73467) has role cholinergic antagonist (CHEBI:48873) |
| 4-DAMP(1+) (CHEBI:73467) has role muscarinic antagonist (CHEBI:48876) |
| 4-DAMP(1+) (CHEBI:73467) is a quaternary ammonium ion (CHEBI:35267) |
| Incoming Relation(s) |
| 4-DAMP methiodide (CHEBI:73340) has part 4-DAMP(1+) (CHEBI:73467) |
| IUPAC Name |
|---|
| 4-(2,2-diphenylacetoxy)-1,1-dimethylpiperidinium |
| Synonyms | Source |
|---|---|
| 4-DAMP | ChemIDplus |
| N,N-dimethyl-4-(diphenylacetoxy)piperidinium | ChEBI |
| 4-Diphenylacetoxy-1,1-dimethylpiperidinium | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3686582 | Reaxys |
| CAS:81405-11-0 | ChemIDplus |