EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73340 - 4-DAMP methiodide
| Formula | C21H26NO2.I |
| Net Charge | 0 |
| Average Mass | 451.348 |
| Monoisotopic Mass | 451.10083 |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1.[I-] |
| InChI | InChI=1S/C21H26NO2.HI/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20H,13-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WWJHRSCUAQPFQO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-DAMP methiodide (CHEBI:73340) has part 4-DAMP(1+) (CHEBI:73467) |
| 4-DAMP methiodide (CHEBI:73340) has role cholinergic antagonist (CHEBI:48873) |
| 4-DAMP methiodide (CHEBI:73340) has role muscarinic antagonist (CHEBI:48876) |
| 4-DAMP methiodide (CHEBI:73340) is a iodide salt (CHEBI:24858) |
| 4-DAMP methiodide (CHEBI:73340) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 4-(2,2-diphenylacetoxy)-1,1-dimethylpiperidinium iodide |
| Synonyms | Source |
|---|---|
| 1,1-dimethyl-4-diphenylacetoxypiperidinium iodide | ChEBI |
| 4-DAMP iodide | ChemIDplus |
| 4-DAMP methyliodide | ChEBI |
| 4-diphenylacetoxy-N-methylpiperidine methiodide | SUBMITTER |
| 4-((Diphenylacetyl)oxy)-1,1-dimethylpiperidinium iodide | ChemIDplus |
| N,N-dimethyl-4-(diphenylacetoxy)piperidinium iodide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3804196 | Reaxys |
| CAS:1952-15-4 | ChemIDplus |
| Citations |
|---|