EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73340 - 4-DAMP methiodide
| Formula | C21H26NO2.I |
| Net Charge | 0 |
| Average Mass | 451.348 |
| Monoisotopic Mass | 451.10083 |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1.[I-] |
| InChI | InChI=1S/C21H26NO2.HI/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,19-20H,13-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WWJHRSCUAQPFQO-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-DAMP methiodide (CHEBI:73340) has part 4-DAMP(1+) (CHEBI:73467) |
| 4-DAMP methiodide (CHEBI:73340) has role cholinergic antagonist (CHEBI:48873) |
| 4-DAMP methiodide (CHEBI:73340) has role muscarinic antagonist (CHEBI:48876) |
| 4-DAMP methiodide (CHEBI:73340) is a iodide salt (CHEBI:24858) |
| 4-DAMP methiodide (CHEBI:73340) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 4-(2,2-diphenylacetoxy)-1,1-dimethylpiperidinium iodide |
| Synonyms | Source |
|---|---|
| 4-diphenylacetoxy-N-methylpiperidine methiodide | SUBMITTER |
| 4-((Diphenylacetyl)oxy)-1,1-dimethylpiperidinium iodide | ChemIDplus |
| 4-DAMP iodide | ChemIDplus |
| 4-DAMP methyliodide | ChEBI |
| 1,1-dimethyl-4-diphenylacetoxypiperidinium iodide | ChEBI |
| N,N-dimethyl-4-(diphenylacetoxy)piperidinium iodide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3804196 | Reaxys |
| CAS:1952-15-4 | ChemIDplus |
| Citations |
|---|