EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N6O11 |
| Net Charge | 0 |
| Average Mass | 518.480 |
| Monoisotopic Mass | 518.19726 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H30N6O11/c20-8(1-6-14(28)29)16(32)25-11(7-15(30)31)18(34)23-9(2-4-12(21)26)17(33)24-10(19(35)36)3-5-13(22)27/h8-11H,1-7,20H2,(H2,21,26)(H2,22,27)(H,23,34)(H,24,33)(H,25,32)(H,28,29)(H,30,31)(H,35,36)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | MNYNINSTBAKKFY-NAKRPEOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Asp-Gln-Gln (CHEBI:73465) has functional parent L-aspartic acid (CHEBI:17053) |
| Glu-Asp-Gln-Gln (CHEBI:73465) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Asp-Gln-Gln (CHEBI:73465) has functional parent L-glutamine (CHEBI:18050) |
| Glu-Asp-Gln-Gln (CHEBI:73465) has role metabolite (CHEBI:25212) |
| Glu-Asp-Gln-Gln (CHEBI:73465) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-aspartyl-L-glutaminyl-L-glutamine |
| Synonyms | Source |
|---|---|
| E-D-Q-Q | ChEBI |
| L-Glu-L-Asp-L-Gln-L-Gln | ChEBI |
| EDQQ | ChEBI |