EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S |
| Net Charge | 0 |
| Average Mass | 208.239 |
| Monoisotopic Mass | 208.05178 |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c7-3(2-13)5(10)8-4(1-9)6(11)12/h3-4,9,13H,1-2,7H2,(H,8,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | YXQDRIRSAHTJKM-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Ser (CHEBI:73462) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Ser (CHEBI:73462) has functional parent L-serine (CHEBI:17115) |
| Cys-Ser (CHEBI:73462) has role metabolite (CHEBI:25212) |
| Cys-Ser (CHEBI:73462) is a carboxylic acid (CHEBI:33575) |
| Cys-Ser (CHEBI:73462) is a dipeptide (CHEBI:46761) |
| Cys-Ser (CHEBI:73462) is a primary alcohol (CHEBI:15734) |
| Cys-Ser (CHEBI:73462) is a primary amino compound (CHEBI:50994) |
| Cys-Ser (CHEBI:73462) is a secondary carboxamide (CHEBI:140325) |
| Cys-Ser (CHEBI:73462) is a thiol (CHEBI:29256) |
| IUPAC Name |
|---|
| L-cysteinyl-L-serine |
| Synonyms | Source |
|---|---|
| C-S | ChEBI |
| CS | ChEBI |
| L-Cys-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028784 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14655380 | Reaxys |