EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O3S |
| Net Charge | 0 |
| Average Mass | 218.278 |
| Monoisotopic Mass | 218.07251 |
| SMILES | N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H14N2O3S/c9-5(4-14)7(11)10-3-1-2-6(10)8(12)13/h5-6,14H,1-4,9H2,(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | ZSRSLWKGWFFVCM-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Pro (CHEBI:73461) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Pro (CHEBI:73461) has functional parent L-proline (CHEBI:17203) |
| Cys-Pro (CHEBI:73461) has role metabolite (CHEBI:25212) |
| Cys-Pro (CHEBI:73461) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-cysteinyl-L-proline |
| Synonyms | Source |
|---|---|
| C-P | ChEBI |
| CP | ChEBI |
| L-Cys-L-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028783 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13311174 | Reaxys |