EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O5S |
| Net Charge | 0 |
| Average Mass | 314.363 |
| Monoisotopic Mass | 314.09364 |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1OC1CCCCC1 |
| InChI | InChI=1S/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 |
| InChIKey | KTDZCOWXCWUPEO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NS-398 (CHEBI:73458) has functional parent 4-nitroaniline (CHEBI:17064) |
| NS-398 (CHEBI:73458) has role antineoplastic agent (CHEBI:35610) |
| NS-398 (CHEBI:73458) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| NS-398 (CHEBI:73458) is a C-nitro compound (CHEBI:35716) |
| NS-398 (CHEBI:73458) is a aromatic ether (CHEBI:35618) |
| NS-398 (CHEBI:73458) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[2-(cyclohexyloxy)-4-nitrophenyl]methanesulfonamide |
| Synonyms | Source |
|---|---|
| N-(2-Cyclohexyloxy-4-nitrophenyl)methanesulfonamide | ChemIDplus |
| NS 398 | ChemIDplus |
| NS398 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-6616 | LINCS |
| NS-398 | Wikipedia |
| US2010152297 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6611485 | Reaxys |
| CAS:123653-11-2 | ChemIDplus |
| Citations |
|---|