EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N4O7 |
| Net Charge | 0 |
| Average Mass | 386.405 |
| Monoisotopic Mass | 386.18015 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CC(=O)O)C(=O)NCC(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C16H26N4O7/c1-8(2)13(19-14(24)9(17)6-12(22)23)15(25)18-7-11(21)20-5-3-4-10(20)16(26)27/h8-10,13H,3-7,17H2,1-2H3,(H,18,25)(H,19,24)(H,22,23)(H,26,27)/t9-,10-,13-/m0/s1 |
| InChIKey | VXEORMGBKTUUCM-KWBADKCTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-Val-Gly-Pro (CHEBI:73441) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-Val-Gly-Pro (CHEBI:73441) has functional parent L-proline (CHEBI:17203) |
| Asp-Val-Gly-Pro (CHEBI:73441) has functional parent L-valine (CHEBI:16414) |
| Asp-Val-Gly-Pro (CHEBI:73441) has functional parent glycine (CHEBI:15428) |
| Asp-Val-Gly-Pro (CHEBI:73441) has role metabolite (CHEBI:25212) |
| Asp-Val-Gly-Pro (CHEBI:73441) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-valylglycyl-L-proline |
| Synonyms | Source |
|---|---|
| D-V-G-P | ChEBI |
| DVGP | ChEBI |
| L-Asp-L-Val-Gly-L-Pro | ChEBI |