EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N7O7S |
| Net Charge | 0 |
| Average Mass | 563.637 |
| Monoisotopic Mass | 563.21622 |
| SMILES | CSCC[C@H](NC(=O)[C@@H](N)CC(N)=O)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H33N7O7S/c1-39-7-6-16(29-21(34)14(25)9-19(26)32)22(35)30-17(23(36)31-18(24(37)38)10-20(27)33)8-12-11-28-15-5-3-2-4-13(12)15/h2-5,11,14,16-18,28H,6-10,25H2,1H3,(H2,26,32)(H2,27,33)(H,29,34)(H,30,35)(H,31,36)(H,37,38)/t14-,16-,17-,18-/m0/s1 |
| InChIKey | BNPVNZIUVMQZPU-DKIMLUQUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Met-Trp-Asn (CHEBI:73412) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Met-Trp-Asn (CHEBI:73412) has functional parent L-methionine (CHEBI:16643) |
| Asn-Met-Trp-Asn (CHEBI:73412) has functional parent L-tryptophan (CHEBI:16828) |
| Asn-Met-Trp-Asn (CHEBI:73412) has role metabolite (CHEBI:25212) |
| Asn-Met-Trp-Asn (CHEBI:73412) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-asparaginyl-L-methionyl-L-tryptophyl-L-asparagine |
| Synonyms | Source |
|---|---|
| N-M-W-N | ChEBI |
| NMWN | ChEBI |
| L-Asn-L-Met-L-Trp-L-Asn | ChEBI |