EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31N7O6S2 |
| Net Charge | 0 |
| Average Mass | 481.601 |
| Monoisotopic Mass | 481.17772 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C16H31N7O6S2/c1-7(24)11(23-12(25)8(17)3-2-4-20-16(18)19)14(27)21-9(5-30)13(26)22-10(6-31)15(28)29/h7-11,24,30-31H,2-6,17H2,1H3,(H,21,27)(H,22,26)(H,23,25)(H,28,29)(H4,18,19,20)/t7-,8+,9+,10+,11+/m1/s1 |
| InChIKey | FXWALQSAZZPDOT-NMUGVGKYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Thr-Cys-Cys (CHEBI:73404) has functional parent L-arginine (CHEBI:16467) |
| Arg-Thr-Cys-Cys (CHEBI:73404) has functional parent L-cysteine (CHEBI:17561) |
| Arg-Thr-Cys-Cys (CHEBI:73404) has functional parent L-threonine (CHEBI:16857) |
| Arg-Thr-Cys-Cys (CHEBI:73404) has role metabolite (CHEBI:25212) |
| Arg-Thr-Cys-Cys (CHEBI:73404) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-arginyl-L-threonyl-L-cysteinyl-L-cysteine |
| Synonyms | Source |
|---|---|
| R-T-C-C | ChEBI |
| RTCC | ChEBI |
| L-Arg-L-Thr-L-Cys-L-Cys | ChEBI |