EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H37N7O5S |
| Net Charge | 0 |
| Average Mass | 571.704 |
| Monoisotopic Mass | 571.25769 |
| SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C27H37N7O5S/c28-19(12-7-13-31-27(29)30)23(35)32-20(14-17-8-3-1-4-9-17)24(36)33-21(15-18-10-5-2-6-11-18)25(37)34-22(16-40)26(38)39/h1-6,8-11,19-22,40H,7,12-16,28H2,(H,32,35)(H,33,36)(H,34,37)(H,38,39)(H4,29,30,31)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | RYAOESLKINBXFH-CMOCDZPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Phe-Phe-Cys (CHEBI:73402) has functional parent L-arginine (CHEBI:16467) |
| Arg-Phe-Phe-Cys (CHEBI:73402) has functional parent L-cysteine (CHEBI:17561) |
| Arg-Phe-Phe-Cys (CHEBI:73402) has functional parent L-phenylalanine (CHEBI:17295) |
| Arg-Phe-Phe-Cys (CHEBI:73402) has role metabolite (CHEBI:25212) |
| Arg-Phe-Phe-Cys (CHEBI:73402) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-arginyl-L-phenylalanyl-L-phenylalanyl-L-cysteine |
| Synonyms | Source |
|---|---|
| R-F-F-C | ChEBI |
| RFFC | ChEBI |
| L-Arg-L-Phe-L-Phe-L-Cys | ChEBI |