EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4 |
| Net Charge | 0 |
| Average Mass | 176.172 |
| Monoisotopic Mass | 176.07971 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C6H12N2O4/c1-3(7)5(10)8-4(2-9)6(11)12/h3-4,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | IPWKGIFRRBGCJO-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ser (CHEBI:73394) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ser (CHEBI:73394) has functional parent L-serine (CHEBI:17115) |
| Ala-Ser (CHEBI:73394) has role metabolite (CHEBI:25212) |
| Ala-Ser (CHEBI:73394) is a dipeptide (CHEBI:46761) |
| Ala-Ser (CHEBI:73394) is tautomer of Ala-Ser zwitterion (CHEBI:233101) |
| Incoming Relation(s) |
| Ala-Ser zwitterion (CHEBI:233101) is tautomer of Ala-Ser (CHEBI:73394) |
| IUPAC Name |
|---|
| L-alanyl-L-serine |
| Synonyms | Source |
|---|---|
| Alanylserine | HMDB |
| A-S | ChEBI |
| AS | ChEBI |
| L-Ala-L-Ser | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028696 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726192 | Reaxys |