EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4 |
| Net Charge | 0 |
| Average Mass | 176.172 |
| Monoisotopic Mass | 176.07971 |
| SMILES | C[C@H]([NH3+])C(=O)N[C@@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O4/c1-3(7)5(10)8-4(2-9)6(11)12/h3-4,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | IPWKGIFRRBGCJO-IMJSIDKUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ser zwitterion (CHEBI:233101) is a L-aminoacyl-L-amino acid zwitterion (CHEBI:77460) |
| Ala-Ser zwitterion (CHEBI:233101) is tautomer of Ala-Ser (CHEBI:73394) |
| Incoming Relation(s) |
| Ala-Ser (CHEBI:73394) is tautomer of Ala-Ser zwitterion (CHEBI:233101) |
| UniProt Name | Source |
|---|---|
| L-alanyl-L-serine | UniProt |
| Citations |
|---|