EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H33N7O6S |
| Net Charge | 0 |
| Average Mass | 463.561 |
| Monoisotopic Mass | 463.22130 |
| SMILES | CSCC[C@H](NC(=O)[C@H](C)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C17H33N7O6S/c1-9(18)13(26)22-10(5-7-31-2)14(27)24-12(8-25)15(28)23-11(16(29)30)4-3-6-21-17(19)20/h9-12,25H,3-8,18H2,1-2H3,(H,22,26)(H,23,28)(H,24,27)(H,29,30)(H4,19,20,21)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | NEBFIUZIGRTIFY-BJDJZHNGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Met-Ser-Arg (CHEBI:73376) has functional parent L-alanine (CHEBI:16977) |
| Ala-Met-Ser-Arg (CHEBI:73376) has functional parent L-arginine (CHEBI:16467) |
| Ala-Met-Ser-Arg (CHEBI:73376) has functional parent L-methionine (CHEBI:16643) |
| Ala-Met-Ser-Arg (CHEBI:73376) has functional parent L-serine (CHEBI:17115) |
| Ala-Met-Ser-Arg (CHEBI:73376) has role metabolite (CHEBI:25212) |
| Ala-Met-Ser-Arg (CHEBI:73376) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-alanyl-L-methionyl-L-seryl-L-arginine |
| Synonyms | Source |
|---|---|
| A-M-S-R | ChEBI |
| AMSR | ChEBI |
| L-Ala-L-Met-L-Ser-L-Arg | ChEBI |