EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O6 |
| Net Charge | 0 |
| Average Mass | 261.234 |
| Monoisotopic Mass | 261.09609 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C9H15N3O6/c1-4(10)8(17)12-5(2-6(13)14)9(18)11-3-7(15)16/h4-5H,2-3,10H2,1H3,(H,11,18)(H,12,17)(H,13,14)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | KIUYPHAMDKDICO-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Asp-Gly (CHEBI:73341) has functional parent L-alanine (CHEBI:16977) |
| Ala-Asp-Gly (CHEBI:73341) has functional parent L-aspartic acid (CHEBI:17053) |
| Ala-Asp-Gly (CHEBI:73341) has functional parent glycine (CHEBI:15428) |
| Ala-Asp-Gly (CHEBI:73341) has role metabolite (CHEBI:25212) |
| Ala-Asp-Gly (CHEBI:73341) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-α-aspartylglycine |
| Synonyms | Source |
|---|---|
| A-D-G | ChEBI |
| ADG | ChEBI |
| L-Ala-L-Asp-Gly | ChEBI |