EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O4 |
| Net Charge | 0 |
| Average Mass | 217.225 |
| Monoisotopic Mass | 217.10626 |
| SMILES | C[C@H](N)C(=O)N[C@@H](C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-4(9)7(14)11-5(2)8(15)10-3-6(12)13/h4-5H,3,9H2,1-2H3,(H,10,15)(H,11,14)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | RLMISHABBKUNFO-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Ala-Gly (CHEBI:73318) has functional parent L-alanine (CHEBI:16977) |
| Ala-Ala-Gly (CHEBI:73318) has functional parent glycine (CHEBI:15428) |
| Ala-Ala-Gly (CHEBI:73318) has role metabolite (CHEBI:25212) |
| Ala-Ala-Gly (CHEBI:73318) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanyl-L-alanylglycine |
| Synonyms | Source |
|---|---|
| A-A-G | ChEBI |
| AAG | ChEBI |
| L-Ala-L-Ala-Gly | ChEBI |