EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25FO5S |
| Net Charge | 0 |
| Average Mass | 444.524 |
| Monoisotopic Mass | 444.14067 |
| SMILES | [H][C@@]1(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H25FO5S/c1-13-2-3-15(24-23(29)22(28)21(27)19(12-26)30-24)10-16(13)11-18-8-9-20(31-18)14-4-6-17(25)7-5-14/h2-10,19,21-24,26-29H,11-12H2,1H3/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | XTNGUQKDFGDXSJ-ZXGKGEBGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canagliflozin (CHEBI:73274) has role hypoglycemic agent (CHEBI:35526) |
| canagliflozin (CHEBI:73274) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| canagliflozin (CHEBI:73274) is a C-glycosyl compound (CHEBI:20857) |
| canagliflozin (CHEBI:73274) is a organofluorine compound (CHEBI:37143) |
| canagliflozin (CHEBI:73274) is a thiophenes (CHEBI:26961) |
| Incoming Relation(s) |
| canagliflozin hydrate (CHEBI:73272) has part canagliflozin (CHEBI:73274) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol |
| Synonym | Source |
|---|---|
| 1-(Glucopyranosyl)-4-methyl-3-(5-(4-fluorophenyl)-2-thienylmethyl)benzene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2008146515 | Patent |
| US2010099883 | Patent |
| US2012289694 | Patent |
| WO2009035969 | Patent |
| WO2011142478 | Patent |
| Canagliflozin | Wikipedia |
| 4758 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18362681 | Reaxys |
| CAS:842133-18-0 | ChemIDplus |
| Citations |
|---|