EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C24H25FO5S.H2O |
| Net Charge | 0 |
| Average Mass | 907.063 |
| Monoisotopic Mass | 906.29191 |
| SMILES | O.[H][C@@]1(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.[H][C@@]1(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/2C24H25FO5S.H2O/c2*1-13-2-3-15(24-23(29)22(28)21(27)19(12-26)30-24)10-16(13)11-18-8-9-20(31-18)14-4-6-17(25)7-5-14;/h2*2-10,19,21-24,26-29H,11-12H2,1H3;1H2/t2*19-,21-,22+,23-,24+;/m11./s1 |
| InChIKey | VHOFTEAWFCUTOS-TUGBYPPCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canagliflozin hydrate (CHEBI:73272) has part canagliflozin (CHEBI:73274) |
| canagliflozin hydrate (CHEBI:73272) has role hypoglycemic agent (CHEBI:35526) |
| canagliflozin hydrate (CHEBI:73272) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| canagliflozin hydrate (CHEBI:73272) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(3-{[5-(4-fluorophenyl)-2-thienyl]methyl}-4-methylphenyl)-D-glucitol—water (2/1) |
| INN | Source |
|---|---|
| canagliflozin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| canagliflozin hemihydrate | ChEBI |
| JNJ-28431754 | ChemIDplus |
| (1S)-1,5-Anhydro-1-(3-((5-(4-fluorophenyl)-2-thienyl)methyl)-4-methylphenyl)-D-glucitol hemihydrate | ChemIDplus |
| TA-7284 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Invokana | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D09592 | KEGG DRUG |
| US2008146515 | Patent |
| Canagliflozin | Wikipedia |
| WO2011142478 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18362683 | Reaxys |
| Citations |
|---|