EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NO7 |
| Net Charge | 0 |
| Average Mass | 413.426 |
| Monoisotopic Mass | 413.14745 |
| SMILES | [H][C@]1([C@@]2([H])c3c(cc4c(c3OC)OCO4)CCN2C)OC(=O)c2c1ccc(OC)c2OC |
| InChI | InChI=1S/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | AKNNEGZIBPJZJG-MSOLQXFVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-noscapine (CHEBI:73237) has functional parent (−)-noscapine hemiacetal (CHEBI:141667) |
| (−)-noscapine (CHEBI:73237) has role antineoplastic agent (CHEBI:35610) |
| (−)-noscapine (CHEBI:73237) has role antitussive (CHEBI:51177) |
| (−)-noscapine (CHEBI:73237) has role apoptosis inducer (CHEBI:68495) |
| (−)-noscapine (CHEBI:73237) has role plant metabolite (CHEBI:76924) |
| (−)-noscapine (CHEBI:73237) is a aromatic ether (CHEBI:35618) |
| (−)-noscapine (CHEBI:73237) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| (−)-noscapine (CHEBI:73237) is a cyclic acetal (CHEBI:59770) |
| (−)-noscapine (CHEBI:73237) is a isobenzofuranone (CHEBI:55372) |
| (−)-noscapine (CHEBI:73237) is a organic heterobicyclic compound (CHEBI:27171) |
| (−)-noscapine (CHEBI:73237) is a organic heterotricyclic compound (CHEBI:26979) |
| (−)-noscapine (CHEBI:73237) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (3S)-6,7-dimethoxy-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-2-benzofuran-1(3H)-one |
| INNs | Source |
|---|---|
| noscapina | ChemIDplus |
| noscapine | WHO MedNet |
| noscapine | ChemIDplus |
| noscapinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| alpha-Narcotine | KEGG COMPOUND |
| (−)-narcotine | ChemIDplus |
| (−)-α-narcotine | HMDB |
| UniProt Name | Source |
|---|---|
| noscapine | UniProt |
| Citations |
|---|