EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO7 |
| Net Charge | 0 |
| Average Mass | 415.442 |
| Monoisotopic Mass | 415.16310 |
| SMILES | [H][C@]1([C@@]2([H])c3c(cc4c(c3OC)OCO4)CCN2C)OC(O)c2c1ccc(OC)c2OC |
| InChI | InChI=1S/C22H25NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18,22,24H,7-8,10H2,1-4H3/t17-,18+,22?/m1/s1 |
| InChIKey | TZNFGVJRQISOHK-HVHHGIHYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a 2-benzofurans (CHEBI:38831) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a aromatic ether (CHEBI:35618) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a cyclic acetal (CHEBI:59770) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a lactol (CHEBI:38131) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a organic heterobicyclic compound (CHEBI:27171) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a organic heterotricyclic compound (CHEBI:26979) |
| (−)-noscapine hemiacetal (CHEBI:141667) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| (−)-noscapine (CHEBI:73237) has functional parent (−)-noscapine hemiacetal (CHEBI:141667) |
| IUPAC Name |
|---|
| (3S)-6,7-dimethoxy-3-[(5R)-4-methoxy-6-methyl-5,6,7,8-tetrahydro[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-1,3-dihydro-2-benzofuran-1-ol |
| Synonyms | Source |
|---|---|
| (−)-narcotine hemiacetal | ChEBI |
| noscapine hemiacetal | ChEBI |
| (−)-α-narcotine hemiacetal | ChEBI |
| UniProt Name | Source |
|---|---|
| narcotine hemiacetal | UniProt |
| Citations |
|---|