EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | [H][C@@]1(C2c3cccc(O)c3C(=O)c3c(O)cc(CO)cc32)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14?,17-,19+,20-,21+/m1/s1 |
| InChIKey | AFHJQYHRLPMKHU-CGISPIQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aloin (CHEBI:73222) has part aloin A (CHEBI:2991) |
| aloin (CHEBI:73222) has part aloin B (CHEBI:74131) |
| aloin (CHEBI:73222) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| aloin (CHEBI:73222) has role laxative (CHEBI:50503) |
| aloin (CHEBI:73222) is a diastereoisomeric mixture (CHEBI:60915) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[4,5-dihydroxy-2-(hydroxymethyl)-10-oxo-9,10-dihydroanthracen-9-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| 10-(1',5'-anhydroglucosyl)aloe-emodin-9-anthrone | ChemIDplus |
| 10-β-D-glucopyranosyl-1,8-dihydroxy-3-hydroxymethyl-9(10H)-anthrone | ChemIDplus |
| 10-β-D-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)anthracen-9(10H)-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aloin | Wikipedia |
| HMDB0035219 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1443124 | Reaxys |
| Citations |
|---|