EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O4 |
| Net Charge | -1 |
| Average Mass | 145.134 |
| Monoisotopic Mass | 145.05063 |
| SMILES | CC[C@H](O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O4/c1-2-4(7)3-5(8)6(9)10/h4,7H,2-3H2,1H3,(H,9,10)/p-1/t4-/m0/s1 |
| InChIKey | ALFQPWXBAWHVDP-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-hydroxy-2-oxohexanoate (CHEBI:73142) is a 4-hydroxy-2-oxohexanoate (CHEBI:53800) |
| (S)-4-hydroxy-2-oxohexanoate (CHEBI:73142) is conjugate base of (S)-4-hydroxy-2-oxohexanoic acid (CHEBI:73151) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxohexanoic acid (CHEBI:73151) is conjugate acid of (S)-4-hydroxy-2-oxohexanoate (CHEBI:73142) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-2-oxohexanoate |
| Synonyms | Source |
|---|---|
| (S)-4-hydroxy-2-ketohexanoate | ChEBI |
| (4S)-4-hydroxy-2-ketohexanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-4-hydroxy-2-oxohexanoate | UniProt |
| Citations |
|---|